Introduction：Basic information about CAS 495-45-4|1,3-diphenyl-2-buten-1-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3-diphenyl-2-buten-1-one |
|---|
| CAS Number | 495-45-4 | Molecular Weight | 222.28200 |
|---|
| Density | 1.06 g/cm3 | Boiling Point | 342.5ºC at 760 mmHg |
|---|
| Molecular Formula | C16H14O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 150.1ºC |
|---|
Names
| Name | 1,3-diphenyl-2-buten-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.06 g/cm3 |
|---|
| Boiling Point | 342.5ºC at 760 mmHg |
|---|
| Molecular Formula | C16H14O |
|---|
| Molecular Weight | 222.28200 |
|---|
| Flash Point | 150.1ºC |
|---|
| Exact Mass | 222.10400 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 3.97280 |
|---|
| Vapour Pressure | 7.5E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.586 |
|---|
| InChIKey | PLELHVCQAULGBH-UHFFFAOYSA-N |
|---|
| SMILES | CC(=CC(=O)c1ccccc1)c1ccccc1 |
|---|
Synonyms
| ar-Styrylacetophenone |
| DYPNONE |
| 1,3-diphenyl-2-butenone |
| Einecs 207-801-6 |
| Dypenone (6ci) |
| 1,3-diphenylbut-2-en-1-one |
| 1-oxo-1,3-diphenyl-2-butene |
