Introduction：Basic information about CAS 4534-73-0|Tetrahydro-3,3'-bifuran-2,2',5,5'-tetrone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tetrahydro-3,3'-bifuran-2,2',5,5'-tetrone |
|---|
| CAS Number | 4534-73-0 | Molecular Weight | 198.130 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 492.0±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H6O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 228.5±28.8 °C |
|---|
Names
| Name | meso-butane-1,2,3,4-tetracarboxylic dianhydride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 492.0±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H6O6 |
|---|
| Molecular Weight | 198.130 |
|---|
| Flash Point | 228.5±28.8 °C |
|---|
| Exact Mass | 198.016434 |
|---|
| PSA | 86.74000 |
|---|
| LogP | -2.20 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.562 |
|---|
| InChIKey | OLQWMCSSZKNOLQ-UHFFFAOYSA-N |
|---|
| SMILES | O=C1CC(C2CC(=O)OC2=O)C(=O)O1 |
|---|
Safety Information
Customs
| HS Code | 2932190090 |
|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| [3,3'-Bifuran]-2,2',5,5'-tetrone, tetrahydro- |
| Tetrahydro-3,3'-bifuran-2,2',5,5'-tetrone |
| Butane-1,2,3,4 tetracarboxylic dianhydride |
| Tetrahydro(3,3'-bifuran)-2,2',5,5'-tetraone |
| Einecs 224-877-6 |
| Butan-1,2,3,4-tetracarbonsaeure-1,2,3,4-dianhydrid |
| 1,2,3,4-Butanetetracarboxylic 1,2:3,4-dianhydride |
| butane-1,2,3,4-tetracarboxylic acid-1,2,3,4-dianhydride |
| (3,3'-Bifuran)-2,2',5,5'-tetrone, tetrahydro- |
| 1,2,3,4-BUTANETETRACARBOXYLIC DIANHYDRIDE |
| Butan-1,2,3,4-tetracarbonsaeure-dianhydrid |
