Introduction：Basic information about CAS 331763-60-1|fmoc-(r)-3-amino-4-(4-chloro-phenyl)-butyric acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | fmoc-(r)-3-amino-4-(4-chloro-phenyl)-butyric acid |
|---|
| CAS Number | 331763-60-1 | Molecular Weight | 435.900 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 653.6±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H22ClNO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 349.1±31.5 °C |
|---|
Names
| Name | (3R)-4-(4-chlorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 653.6±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H22ClNO4 |
|---|
| Molecular Weight | 435.900 |
|---|
| Flash Point | 349.1±31.5 °C |
|---|
| Exact Mass | 435.123749 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 6.22 |
|---|
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.629 |
|---|
| InChIKey | FMGGSUXYRDKFJX-GOSISDBHSA-N |
|---|
| SMILES | O=C(O)CC(Cc1ccc(Cl)cc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
|---|
Synonyms
| FMOC-(R)-3-AMINO-4-(4-CHLORO-PHENYL)-BUTYRICACID |
| (R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(4-chlorophenyl)butanoic acid |
| V1016 |
| (3R)-4-(4-Chlorophenyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}butanoic acid |
| Benzenebutanoic acid, 4-chloro-β-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-, (βR)- |
