Introduction：Basic information about CAS 651744-26-2|4-fluoro-1-(phenylsulfonyl)-1h-pyrrolo[2,3-b]pyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-fluoro-1-(phenylsulfonyl)-1h-pyrrolo[2,3-b]pyridine |
|---|
| CAS Number | 651744-26-2 | Molecular Weight | 276.286 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 468.6±48.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H9FN2O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 237.2±29.6 °C |
|---|
Names
| Name | 4-fluoro-1-(phenylsulfonyl)-1h-pyrrolo[2,3-b]pyridine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 468.6±48.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H9FN2O2S |
|---|
| Molecular Weight | 276.286 |
|---|
| Flash Point | 237.2±29.6 °C |
|---|
| Exact Mass | 276.036865 |
|---|
| PSA | 60.34000 |
|---|
| LogP | 2.30 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.653 |
|---|
| InChIKey | DCJFEBQGYAKWHV-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(c1ccccc1)n1ccc2c(F)ccnc21 |
|---|
Synonyms
| 1-(Phenylsulphonyl)-4-fluoro-7-azaindole |
| 4-Fluoro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine |
| 1H-Pyrrolo[2,3-b]pyridine,4-fluoro-1-(phenylsulfonyl) |
| 1H-Pyrrolo[2,3-b]pyridine, 4-fluoro-1-(phenylsulfonyl)- |
