Introduction：Basic information about CAS 98815-38-4|[D-Ala2,4,Tyr5] -b-Casomorphin (1-5), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [D-Ala2,4,Tyr5] -b-Casomorphin (1-5) |
|---|
| CAS Number | 98815-38-4 | Molecular Weight | 632.70700 |
|---|
| Density | 1.304 g/cm3 | Boiling Point | 1108.9ºC at 760 mmHg |
|---|
| Molecular Formula | C33H40N6O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 624.4ºC |
|---|
Names
| Name | (2S)-2-amino-N-[(2R)-1-[[(2S)-1-[[(2R)-1-[[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-1-oxopropan-2-yl]-3-(4-hydroxyphenyl)propanamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.304 g/cm3 |
|---|
| Boiling Point | 1108.9ºC at 760 mmHg |
|---|
| Molecular Formula | C33H40N6O7 |
|---|
| Molecular Weight | 632.70700 |
|---|
| Flash Point | 624.4ºC |
|---|
| Exact Mass | 632.29600 |
|---|
| PSA | 225.97000 |
|---|
| LogP | 2.88150 |
|---|
| Index of Refraction | 1.618 |
|---|
| InChIKey | XDRHVZLDLNGKLM-FLVVDCEDSA-N |
|---|
| SMILES | CC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(Cc1ccccc1)C(=O)NC(C)C(=O)NC(Cc1ccc(O)cc1)C(N)=O |
|---|
Synonyms
| Casokefamida |
| UNII-B453T1E8MP |
| Casokefamide |
| Casokefamidum |
| [D-Ala2,4,Tyr5] -b-Casomorphin (1-5) |
