Introduction:Basic information about CAS 23616-79-7|Benzyltributylammonium chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzyltributylammonium chloride |
|---|
| CAS Number | 23616-79-7 | Molecular Weight | 311.933 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C19H34ClN | Melting Point | 155-163 °C(lit.) |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | benzyl(tributyl)azanium,chloride |
|---|
| Synonym | More Synonyms |
|---|
Benzyltributylammonium chloride BiologicalActivity
| Description | Tributylbenzylammonium chloride is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|
| Related Catalog | Research Areas >>Others |
|---|
Chemical & Physical Properties
| Melting Point | 155-163 °C(lit.) |
|---|
| Molecular Formula | C19H34ClN |
|---|
| Molecular Weight | 311.933 |
|---|
| Exact Mass | 311.237976 |
|---|
| LogP | 2.40770 |
|---|
| InChIKey | VJGNLOIQCWLBJR-UHFFFAOYSA-M |
|---|
| SMILES | CCCC[N+](CCCC)(CCCC)Cc1ccccc1.[Cl-] |
|---|
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
|---|
| Water Solubility | soluble |
|---|
Safety Information
| Hazard Codes | Xn:Harmful |
|---|
| Risk Phrases | R22;R36/37/38 |
|---|
| Safety Phrases | S26-S36-S37/39-S45-S36/37/39 |
|---|
| RIDADR | UN 3263 8/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 29239000 |
|---|
Customs
| HS Code | 2923900090 |
|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Benzenemethanaminium, N,N,N-tributyl-, chloride |
| Benzenemethanaminium, N,N,N-tributyl-, chloride (1:1) |
| EINECS 245-787-3 |
| MFCD00011849 |
| N-Benzyl-N,N-dibutyl-1-butanaminium chloride |
| tributylbenzylammonium chloride |
| Benzyltributylammonium chloride |
| benzyltri-n-butylammonium chloride |
| Benzenemethanaminium,N,N,N-tributyl-,chloride |
| BTBAC |
| N-Benzyl-N,N-dibutylbutan-1-aminium chloride |