Introduction:Basic information about CAS 477593-22-9|1-(5-Bromo-2-chloropyrimidin-4-yl)piperidin-4-ol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(5-Bromo-2-chloropyrimidin-4-yl)piperidin-4-ol |
|---|
| CAS Number | 477593-22-9 | Molecular Weight | 292.56000 |
|---|
| Density | 1.688g/cm3 | Boiling Point | 466.005ºC at 760 mmHg |
|---|
| Molecular Formula | C9H11BrClN3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 235.632ºC |
|---|
Names
| Name | 1-(5-Bromo-2-chloropyrimidin-4-yl)piperidin-4-ol |
|---|
Chemical & Physical Properties
| Density | 1.688g/cm3 |
|---|
| Boiling Point | 466.005ºC at 760 mmHg |
|---|
| Molecular Formula | C9H11BrClN3O |
|---|
| Molecular Weight | 292.56000 |
|---|
| Flash Point | 235.632ºC |
|---|
| Exact Mass | 290.97700 |
|---|
| PSA | 49.25000 |
|---|
| LogP | 1.91860 |
|---|
| Index of Refraction | 1.627 |
|---|
| InChIKey | AKRUDFYNASAKIO-UHFFFAOYSA-N |
|---|
| SMILES | OC1CCN(c2nc(Cl)ncc2Br)CC1 |
|---|