Introduction：Basic information about CAS 98591-49-2|3,5-Dibromo-1H-indole-2-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,5-Dibromo-1H-indole-2-carboxylic acid |
|---|
| CAS Number | 98591-49-2 | Molecular Weight | 318.95000 |
|---|
| Density | 2.173g/cm3 | Boiling Point | 500.9ºC at 760mmHg |
|---|
| Molecular Formula | C9H5Br2NO2 | Melting Point | 230ºC(dec) |
|---|
| MSDS | / | Flash Point | 256.7ºC |
|---|
Names
| Name | 3,5-Dibromo-1H-indole-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.173g/cm3 |
|---|
| Boiling Point | 500.9ºC at 760mmHg |
|---|
| Melting Point | 230ºC(dec) |
|---|
| Molecular Formula | C9H5Br2NO2 |
|---|
| Molecular Weight | 318.95000 |
|---|
| Flash Point | 256.7ºC |
|---|
| Exact Mass | 316.86900 |
|---|
| PSA | 53.09000 |
|---|
| LogP | 3.39110 |
|---|
| Index of Refraction | 1.767 |
|---|
| InChIKey | ATMGPBPNXBMNBK-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1[nH]c2ccc(Br)cc2c1Br |
|---|
Synonyms
| 3,5-dibromo-indole-2-carboxylic acid |
| 3,5-Dibrom-indol-2-carbonsaeure |
| dibromoindolecarboxylicacid |
| LA-0921 |
