CAS 77-63-4|2,4,6,8-tetramethyl-2,4,6,8-tetraphenylcyclotetrasiloxane
Introduction:Basic information about CAS 77-63-4|2,4,6,8-tetramethyl-2,4,6,8-tetraphenylcyclotetrasiloxane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4,6,8-tetramethyl-2,4,6,8-tetraphenylcyclotetrasiloxane | ||
|---|---|---|---|
| CAS Number | 77-63-4 | Molecular Weight | 544.893 |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 493.2±28.0 °C at 760 mmHg |
| Molecular Formula | C28H32O4Si4 | Melting Point | 99°C |
| MSDS | / | Flash Point | 211.7±24.4 °C |
Names
| Name | 2,4,6,8-tetramethyl-2,4,6,8-tetraphenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 493.2±28.0 °C at 760 mmHg |
| Melting Point | 99°C |
| Molecular Formula | C28H32O4Si4 |
| Molecular Weight | 544.893 |
| Flash Point | 211.7±24.4 °C |
| Exact Mass | 544.137756 |
| PSA | 36.92000 |
| LogP | 3.98320 |
| Appearance of Characters | solid |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | IRVZFACCNZRHSJ-UHFFFAOYSA-N |
| SMILES | C[Si]1(c2ccccc2)O[Si](C)(c2ccccc2)O[Si](C)(c2ccccc2)O[Si](C)(c2ccccc2)O1 |
| Storage condition | 2~8°C |
Safety Information
| RTECS | NI6755100 |
|---|
Synonyms
| tetramethyltetraphenylcyclotetrasiloxane |
| CYCLOTETRASILOXANE,2,4,6,8-TETRAMETHYL-2,4,6,8-TETRAPHENYL |
| 1,3,5,7-tetramethyltetraphenylcyclotetrasiloxane |
| EINECS 201-045-0 |
| 2,4,6,8-Tetramethyl-2,4,6,8-tetraphenyl-[1,3,5,7,2,4,6,8]cyclotetrasiloxane |
| 2,4,6,8-tetraphenyl-2,4,6,8-tetramethylcyclotetrasiloxane |
| Cyclotetrasiloxane, 2,4,6,8-tetramethyl-2,4,6,8-tetraphenyl- |
| 1.3.5'.7'-Tetramethyl-1'.3'.5.7-tetraphenylcyclotetrasiloxan |
| 1,3,5,7-tetramethyl-1,3,5,7-tetraphenylcyclotetrasiloxane |
| 2,4,6,8-Tetramethyl-2,4,6,8-tetraphenyl-cyclotetrasiloxan |
| 2,4,6,8-Tetramethyl-2,4,6,8-tetraphenylcyclotetrasiloxane |
| 2,4,6,8-Tetramethyl-2,4,6,8-tetraphenyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane |
