Introduction：Basic information about CAS 493-90-3|7,12-diethyl-3,8,13,17-tetramethyl-21H,23H-porphine-2,18-dipropionic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7,12-diethyl-3,8,13,17-tetramethyl-21H,23H-porphine-2,18-dipropionic acid |
|---|
| CAS Number | 493-90-3 | Molecular Weight | 639.61200 |
|---|
| Density | 1.24 g/cm3 | Boiling Point | 1096.1ºCat 760 mmHg |
|---|
| Molecular Formula | C34H40Cl2N4O4 | Melting Point | >270ºC |
|---|
| MSDS | / | Flash Point | 616.7ºC |
|---|
Names
| Name | Mesoporphyrin(IX) dihydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.24 g/cm3 |
|---|
| Boiling Point | 1096.1ºCat 760 mmHg |
|---|
| Melting Point | >270ºC |
|---|
| Molecular Formula | C34H40Cl2N4O4 |
|---|
| Molecular Weight | 639.61200 |
|---|
| Flash Point | 616.7ºC |
|---|
| Exact Mass | 638.24300 |
|---|
| PSA | 130.90000 |
|---|
| LogP | 5.78800 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.616 |
|---|
| InChIKey | NCAJWYASAWUEBY-UHFFFAOYSA-N |
|---|
| SMILES | CCc1c(C)c2cc3[nH]c(cc4nc(cc5nc(cc1[nH]2)C(C)=C5CCC(=O)O)C(CCC(=O)O)=C4C)c(C)c3CC |
|---|
Synonyms
| 2,4-diethyl-aniline |
| 2,4-Diethylbenzenamine |
| 2,4-Diaethyl-anilin |
| 2,4-Diethylanilin |
| 2,4-dimethylmethylaniline |
| 2,4-diethyldeuteroporphyrin |
| 4-Amino-1.3-diaethyl-benzol |
| 7,12-diethyl-3,8,13,17-tetramethyl-21H,23H-porphine-2,18-dipropionic acid |
| Mesoporphyrin IX |
| Benzenamine,2,4-diethyl |
| Mesoporphyrin |
| 2,4-diethyl-1-aminobenzene |
