Introduction：Basic information about CAS 18942-50-2|Boc-Ser(tBu)-OH·DCHA, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Boc-Ser(tBu)-OH·DCHA |
|---|
| CAS Number | 18942-50-2 | Molecular Weight | 442.63200 |
|---|
| Density | / | Boiling Point | 571.1ºC at 760 mmHg |
|---|
| Molecular Formula | C24H46N2O5 | Melting Point | 161-164ºC |
|---|
| MSDS | USA | Flash Point | 299.2ºC |
|---|
Names
| Name | N-cyclohexylcyclohexanamine,(2S)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 571.1ºC at 760 mmHg |
|---|
| Melting Point | 161-164ºC |
|---|
| Molecular Formula | C24H46N2O5 |
|---|
| Molecular Weight | 442.63200 |
|---|
| Flash Point | 299.2ºC |
|---|
| Exact Mass | 442.34100 |
|---|
| PSA | 96.89000 |
|---|
| LogP | 5.80260 |
|---|
| Vapour Pressure | 1.56E-14mmHg at 25°C |
|---|
| InChIKey | AIEUUHIXSUNTGV-QRPNPIFTSA-N |
|---|
| SMILES | C1CCC(NC2CCCCC2)CC1.CC(C)(C)OCC(NC(=O)OC(C)(C)C)C(=O)O |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xi |
|---|
| Safety Phrases | 22-24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| L-BocSer(OtBu)OH*DCHA |
| Boc-Ser(tBu)-OH,DCHA |
| N-tert-butoxycarbonyl-O-tert-butyl-L-serine dicyclohexylammonium salt |
| N-Cyclohexylcyclohexanaminium 3-[(2-methyl-2-propanyl)oxy]-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoate |
| Serine, N-[(1,1-dimethylethoxy)carbonyl]-O-(1,1-dimethylethyl)-, compd. with N-cyclohexylcyclohexanamine (1:1) |
| MFCD00065590 |
| Boc-O-tert-butyl-L-serine dicyclohexylamine salt |
| Boc-Ser(tBu)-OH·DCHA |
