Introduction：Basic information about CAS 6370-75-8|Vat Yellow 12 (C.I.), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Vat Yellow 12 (C.I.) |
|---|
| CAS Number | 6370-75-8 | Molecular Weight | 430.53400 |
|---|
| Density | 1.537g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C25H34O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
Chemical & Physical Properties
| Density | 1.537g/cm3 |
|---|
| Molecular Formula | C25H34O6 |
|---|
| Molecular Weight | 430.53400 |
|---|
| Exact Mass | 430.23600 |
|---|
| PSA | 97.74000 |
|---|
| LogP | 4.11000 |
|---|
| Index of Refraction | 1.791 |
|---|
| InChIKey | NIBQRIIYVCTBDX-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Nc1cccc2c1C(=O)c1cccc(NC(=O)c3ccccc3)c1C2=O)C(=O)Nc1cccc2c1C(=O)c1cccc(NC(=O)c3ccccc3)c1C2=O |
|---|
