Introduction：Basic information about CAS 63740-81-8|7-HYDROXYWARFARIN, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-HYDROXYWARFARIN |
|---|
| CAS Number | 63740-81-8 | Molecular Weight | 329.35800 |
|---|
| Density | 1.384g/cm3 | Boiling Point | 540.2ºC at 760 mmHg |
|---|
| Molecular Formula | C19H11D5O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 197.7ºC |
|---|
Names
| Name | 4,7-dihydroxy-3-[(1S)-3-oxo-1-phenylbutyl]chromen-2-one |
|---|
Chemical & Physical Properties
| Density | 1.384g/cm3 |
|---|
| Boiling Point | 540.2ºC at 760 mmHg |
|---|
| Molecular Formula | C19H11D5O5 |
|---|
| Molecular Weight | 329.35800 |
|---|
| Flash Point | 197.7ºC |
|---|
| Exact Mass | 329.13100 |
|---|
| PSA | 87.74000 |
|---|
| LogP | 3.31520 |
|---|
| Index of Refraction | 1.658 |
|---|
| InChIKey | SKFYEJMLNMTTJA-HNNXBMFYSA-N |
|---|
| SMILES | CC(=O)CC(c1ccccc1)c1c(O)c2ccc(O)cc2oc1=O |
|---|
