Introduction:Basic information about CAS 64172-98-1|4-N-CBZ-2-piperazine carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-N-CBZ-2-piperazine carboxylic acid |
|---|
| CAS Number | 64172-98-1 | Molecular Weight | 264.277 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 465.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H16N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 235.1±28.7 °C |
|---|
Names
| Name | 4-phenylmethoxycarbonylpiperazine-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 465.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H16N2O4 |
|---|
| Molecular Weight | 264.277 |
|---|
| Flash Point | 235.1±28.7 °C |
|---|
| Exact Mass | 264.110992 |
|---|
| PSA | 78.87000 |
|---|
| LogP | 0.88 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.569 |
|---|
| InChIKey | ARLOIFJEXPDJGV-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C1CN(C(=O)OCc2ccccc2)CCN1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2933599090 |
|---|
Customs
| HS Code | 2933599090 |
|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1,3-Piperazinedicarboxylic acid, 1-(phenylmethyl) ester |
| 4-[(Benzyloxy)carbonyl]-2-piperazinecarboxylic acid |
| 4-carbobenzoxypiperazine-2-carboxylic acid |
| MFCD02179116 |
| 4-Cbz-2-piperazinecarboxylic acid |
| 4-N-CBZ-2-piperazine carboxylic acid |
| 4-N-CBZ-piperazine-2-carboxylic acid |
| N-4-Cbz-2-piperazinecarboxylic acid |
| 4-cbz-piperazine-2-carboxylic acid |
| 4-benzyloxycarbonyl-2-piperazinecarboxylic acid |
| 4-[(Benzyloxy)carbonyl]piperazine-2-carboxylic acid |
| 4-carbobenzyloxypiperazine-2-carboxylic acid |