Introduction:Basic information about CAS 64234-14-6|Bicyclo[2.2.1]heptane-1-carboxylic acid, 7,7-dimethyl-2-oxo-, (1R,4S)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bicyclo[2.2.1]heptane-1-carboxylic acid, 7,7-dimethyl-2-oxo-, (1R,4S)- |
|---|
| CAS Number | 64234-14-6 | Molecular Weight | 182.21600 |
|---|
| Density | 1.238 | Boiling Point | / |
|---|
| Molecular Formula | C10H14O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Bicyclo[2.2.1]heptane-1-carboxylic acid, 7,7-dimethyl-2-oxo-, (1R,4S) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.238 |
|---|
| Molecular Formula | C10H14O3 |
|---|
| Molecular Weight | 182.21600 |
|---|
| Exact Mass | 182.09400 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 1.46640 |
|---|
| InChIKey | WDODWBQJVMBHCO-TYICEKJOSA-N |
|---|
| SMILES | CC1(C)C2CCC1(C(=O)O)C(=O)C2 |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 7,7-dimethyl-2-oxo-norbornane-1-carboxylic acid |