Introduction：Basic information about CAS 5844-01-9|4,6-bis(phenylazo)-o-cresol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,6-bis(phenylazo)-o-cresol |
|---|
| CAS Number | 5844-01-9 | Molecular Weight | 316.35700 |
|---|
| Density | 1.17g/cm3 | Boiling Point | 442.7ºC at 760mmHg |
|---|
| Molecular Formula | C19H16N4O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 221.5ºC |
|---|
Names
| Name | (6E)-2-methyl-4-phenyldiazenyl-6-(phenylhydrazinylidene)cyclohexa-2,4-dien-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.17g/cm3 |
|---|
| Boiling Point | 442.7ºC at 760mmHg |
|---|
| Molecular Formula | C19H16N4O |
|---|
| Molecular Weight | 316.35700 |
|---|
| Flash Point | 221.5ºC |
|---|
| Exact Mass | 316.13200 |
|---|
| PSA | 69.67000 |
|---|
| LogP | 6.53140 |
|---|
| Index of Refraction | 1.63 |
|---|
| InChIKey | RPZZLBYXHLWEOJ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(N=Nc2ccccc2)cc(N=Nc2ccccc2)c1O |
|---|
Synonyms
| EINECS 227-436-6 |
| 4.6-Bis-benzolazo-o-kresol |
| 2-methyl-4,6-bis[(E)-phenyldiazenyl]phenol |
| 2-Methyl-4,6-bis-phenylazo-phenol |
| 3.5-Bis-benzolazo-2-oxy-toluol |
| 4,6-Bis(phenylazo)-o-cresol |
