Introduction：Basic information about CAS 5873-54-1|o-(p-Isocyanatobenzyl)phenyl isocyanate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | o-(p-Isocyanatobenzyl)phenyl isocyanate |
|---|
| CAS Number | 5873-54-1 | Molecular Weight | 250.252 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 376.3±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H10N2O2 | Melting Point | 36-40ºC(lit.) |
|---|
| MSDS | / | Flash Point | 155.3±31.3 °C |
|---|
Names
| Name | 1-Isocyanato-2-(4-isocyanatobenzyl)benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 376.3±35.0 °C at 760 mmHg |
|---|
| Melting Point | 36-40ºC(lit.) |
|---|
| Molecular Formula | C15H10N2O2 |
|---|
| Molecular Weight | 250.252 |
|---|
| Flash Point | 155.3±31.3 °C |
|---|
| Exact Mass | 250.074234 |
|---|
| PSA | 58.86000 |
|---|
| LogP | 4.93 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.588 |
|---|
| InChIKey | LFSYUSUFCBOHGU-UHFFFAOYSA-N |
|---|
| SMILES | O=C=Nc1ccc(Cc2ccccc2N=C=O)cc1 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | 20/21/22-36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
Synonyms
| 1-Isocyanato-2-(4-isocyanatobenzyl)benzene |
| 4-Chlor-1.3-diisocyanato-benzol |
| EINECS 227-534-9 |
| 2,4-diisocyanatochlorobenzene |
| 4-chloro-1,3-phenylene diisocyanate |
| diphenyl-methane 2,4'-diisocyanate |
| o-(p-isocyanatobenzyl)phenyl isocyanate |
| 2-isocyanatophenyl-4'-isocyanatophenylmethane |
| 1-chloro-2,4-phenylene diisocyanate |
| 4-Chlor-m-phenylendiisocyanat |
| 2,4--methylene bis(phenylisocyanate) |
| 2,4'-Diisocyantodiphenylmethane |
| 2,4-diisocyanato-1-chlorobenzene |
| 2,4'-diisocyanato-1,1-methylenedibenzene |
| 4-chloro-m-phenylene diisocyanate |
| Benzene, 1-isocyanato-2-[(4-isocyanatophenyl)methyl]- |
| 2,4'-diisocyanatodiphenylmethane |
