Introduction：Basic information about CAS 33091-17-7|2,2',3,3',4,4',6,6'-octachlorobiphenyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2',3,3',4,4',6,6'-octachlorobiphenyl |
|---|
| CAS Number | 33091-17-7 | Molecular Weight | 429.76800 |
|---|
| Density | 1.716g/cm3 | Boiling Point | 418.2ºC at 760mmHg |
|---|
| Molecular Formula | C12H2Cl8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 203.2ºC |
|---|
Names
| Name | 1,2,3,5-tetrachloro-4-(2,3,4,6-tetrachlorophenyl)benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.716g/cm3 |
|---|
| Boiling Point | 418.2ºC at 760mmHg |
|---|
| Molecular Formula | C12H2Cl8 |
|---|
| Molecular Weight | 429.76800 |
|---|
| Flash Point | 203.2ºC |
|---|
| Exact Mass | 425.76600 |
|---|
| LogP | 8.58080 |
|---|
| Index of Refraction | 1.638 |
|---|
| InChIKey | YPDBBDKYNWRFMF-UHFFFAOYSA-N |
|---|
| SMILES | Clc1cc(Cl)c(-c2c(Cl)cc(Cl)c(Cl)c2Cl)c(Cl)c1Cl |
|---|
Synonyms
| 2,2',3,3',4,4',6,6'-Octachlorobiphenyl |
| 2,3,4,6,2',3',4',6'-Octachlorbiphenyl |
| 2,2',3,3',4,4',6,6'-Octachlorbiphenyl |
| Biphenyl,2,2',3,3',4,4',6,6'-octachloro |
| 1,1'-Biphenyl,2,2',3,3',4,4',6,6'-octachloro |
| 2,2',3,3',4,4',6,6'-heptachlorobiphenyl |
