Introduction:Basic information about CAS 34079-31-7|Z-Pro-NH2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-Pro-NH2 |
|---|
| CAS Number | 34079-31-7 | Molecular Weight | 248.27800 |
|---|
| Density | 1.263g/cm3 | Boiling Point | 465.6ºC at 760mmHg |
|---|
| Molecular Formula | C13H16N2O3 | Melting Point | 92 °C |
|---|
| MSDS | ChineseUSA | Flash Point | 235.4ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | benzyl (2S)-2-carbamoylpyrrolidine-1-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.263g/cm3 |
|---|
| Boiling Point | 465.6ºC at 760mmHg |
|---|
| Melting Point | 92 °C |
|---|
| Molecular Formula | C13H16N2O3 |
|---|
| Molecular Weight | 248.27800 |
|---|
| Flash Point | 235.4ºC |
|---|
| Exact Mass | 248.11600 |
|---|
| PSA | 72.63000 |
|---|
| LogP | 1.91110 |
|---|
| Index of Refraction | 1.581 |
|---|
| InChIKey | ZCGHEBMEQXMRQL-NSHDSACASA-N |
|---|
| SMILES | NC(=O)C1CCCN1C(=O)OCc1ccccc1 |
|---|
| Storage condition | Store at RT. |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 22-36/37/38 |
|---|
| Safety Phrases | 36 |
|---|
| RIDADR | 1691 |
|---|
| HS Code | 2933990090 |
|---|
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| MFCD00020830 |
| Cbz-L-Pro-NH2 |
| Z-L-Prolinamide |
| N-Benzyloxycarbonyl-L-prolinamide |
| benzyl (2S)-2-carbamoylpyrrolidine-1-carboxylate |
| z-pro-nh2 |
| n-carbobenzoxy-l-proline amide |
| Cbz-L-proline amide |
| Benzyl (2S)-2-carbamoyl-1-pyrrolidinecarboxylate |
| Carbobenzyloxy-L-prolinamide |
| N-Cbz-L-prolinamide |
| 1-Cbz-prolinamide |
| z-l-proline amide |
| (S)-Benzyl 2-carbamoylpyrrolidine-1-carboxylate |
| N-Carbobenzoxy-L-prolinamide |
| cbz-l-prolinamide |
| Benzyloxycarbonyl-L-prolinamide |
| CBZ-PRO-NH2 |
| 1-Pyrrolidinecarboxylic acid, 2-(aminocarbonyl)-, phenylmethyl ester, (2S)- |
| Benzyloxycarbonyl-L-prolineamide |