Introduction：Basic information about CAS 65872-43-7|2-(2-Formamidothiazole-4-yl)-2-methoxyimino acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(2-Formamidothiazole-4-yl)-2-methoxyimino acetic acid |
|---|
| CAS Number | 65872-43-7 | Molecular Weight | 229.213 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 438.5±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H7N3O4S | Melting Point | 163 °C (dec.)(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 219.0±31.5 °C |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-(2-Formamidothiazole-4-yl)-2-methoxyimino acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 438.5±55.0 °C at 760 mmHg |
|---|
| Melting Point | 163 °C (dec.)(lit.) |
|---|
| Molecular Formula | C7H7N3O4S |
|---|
| Molecular Weight | 229.213 |
|---|
| Flash Point | 219.0±31.5 °C |
|---|
| Exact Mass | 229.015732 |
|---|
| PSA | 129.12000 |
|---|
| LogP | 0.05 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.664 |
|---|
| InChIKey | NRRJNSWNWIDHOX-YHYXMXQVSA-N |
|---|
| SMILES | CON=C(C(=O)O)c1csc(NC=O)n1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2934100090 |
|---|
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| (2Z)-[2-(formylamino)-1,3-thiazol-4-yl](methoxyimino)ethanoic acid |
| EINECS 265-958-6 |
| MFCD00010413 |
| 4-Thiazoleacetic acid, 2-(formylamino)-α-(methoxyimino)-, (αZ)- |
| (2Z)-(2-Formamido-1,3-thiazol-4-yl)(methoxyimino)acetic acid |
| N-Formyloxamidine Acid |
| 2-(2-Formamidothiazole-4-yl)-2-methoxyimino acetic acid |
