Introduction：Basic information about CAS 92-79-5|3-Hydroxy-4'-methoxy-2-naphthanilide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Hydroxy-4'-methoxy-2-naphthanilide |
|---|
| CAS Number | 92-79-5 | Molecular Weight | 293.31700 |
|---|
| Density | 1.304 g/cm3 | Boiling Point | 426.8ºC at 760 mmHg |
|---|
| Molecular Formula | C18H15NO3 | Melting Point | 229~230℃ |
|---|
| MSDS | / | Flash Point | 211.9ºC |
|---|
Names
| Name | 3-hydroxy-N-(4-methoxyphenyl)naphthalene-2-carboxamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.304 g/cm3 |
|---|
| Boiling Point | 426.8ºC at 760 mmHg |
|---|
| Melting Point | 229~230℃ |
|---|
| Molecular Formula | C18H15NO3 |
|---|
| Molecular Weight | 293.31700 |
|---|
| Flash Point | 211.9ºC |
|---|
| Exact Mass | 293.10500 |
|---|
| PSA | 58.56000 |
|---|
| LogP | 3.87930 |
|---|
| Index of Refraction | 1.703 |
|---|
| InChIKey | UIXFPIHXQQZAGX-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(NC(=O)c2cc3ccccc3cc2O)cc1 |
|---|
Safety Information
| Safety Phrases | S26-S28-S36/37/39-S45-S8-S30-S23 |
|---|
| RIDADR | UN 3265 8/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| EINECS 202-190-2 |
| Naphtazol RL |
| Azoground RL |
| Naphthoide RL |
| Naphthanil RL |
| 3-Hydroxy-[2]naphthoesaeure-p-anisidid |
| Naphtoelan RL |
| 3-hydroxy-naphthalene-2-carboxylic acid 4-methoxy-anilide |
| naphthol AS-RL |
| Naphthol AS-RL Supra |
| Solunaptol PAL |
| 3-hydroxy-[2]naphthoic acid p-anisidide |
| Acna Naphthol R |
| Naphtanilide RL |
| Azonaphtol PA |
| MFCD00021641 |
