Introduction：Basic information about CAS 18105-31-2|Bis(trimethylsilyl) adipate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bis(trimethylsilyl) adipate |
|---|
| CAS Number | 18105-31-2 | Molecular Weight | 290.503 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 241.3±13.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H26O4Si2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 83.0±15.4 °C |
|---|
Names
| Name | bis(trimethylsilyl) adipate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 241.3±13.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H26O4Si2 |
|---|
| Molecular Weight | 290.503 |
|---|
| Flash Point | 83.0±15.4 °C |
|---|
| Exact Mass | 290.136963 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 3.08 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.429 |
|---|
| InChIKey | DVGSOFSBBKDKRU-UHFFFAOYSA-N |
|---|
| SMILES | C[Si](C)(C)OC(=O)CCCCC(=O)O[Si](C)(C)C |
|---|
Safety Information
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| HS Code | 2931900090 |
|---|
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Adipic acid bis(trimethylsilyl) |
| BIS(TRIMETHYSILYL)ADIPATE |
| Adipic acid,diTMS |
| Hexanedioic acid,TMS |
| bis(trimethylsilyl)adipate |
| adipic acid bis-trimethylsilanyl ester |
| Adipic acid, bis(trimethylsilyl) ester |
| BIS(TRIMETHYLSILYL)ADIPIC ACID |
| Bis(trimethylsilyl) adipate |
| Bis(trimethylsilyl)adipat |
| Adipinsaeure-bis-trimethylsilylester |
| Adipic acid,bis-TMS |
| Adipic acid (tms) |
| Bis(trimethylsilyl) hexanedioate |
| Hexanedioic acid, bis(trimethylsilyl) ester |
| EINECS 242-002-6 |
