Introduction:Basic information about CAS 92455-53-3|ZD-Tyr(Bzl)-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ZD-Tyr(Bzl)-OH |
|---|
| CAS Number | 92455-53-3 | Molecular Weight | 405.443 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 624.4±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C24H23NO5 | Melting Point | 113-119 °C |
|---|
| MSDS | / | Flash Point | 331.5±31.5 °C |
|---|
Names
| Name | (2R)-2-(phenylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 624.4±55.0 °C at 760 mmHg |
|---|
| Melting Point | 113-119 °C |
|---|
| Molecular Formula | C24H23NO5 |
|---|
| Molecular Weight | 405.443 |
|---|
| Flash Point | 331.5±31.5 °C |
|---|
| Exact Mass | 405.157623 |
|---|
| PSA | 84.86000 |
|---|
| LogP | 5.15 |
|---|
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.608 |
|---|
| InChIKey | IPAODWFPTVIUSZ-JOCHJYFZSA-N |
|---|
| SMILES | O=C(NC(Cc1ccc(OCc2ccccc2)cc1)C(=O)O)OCc1ccccc1 |
|---|
Synonyms
| Z-Tyr(Bzl)-OH |
| N-benzyloxycarbonyl-O-benzyl-L-tyrosine |
| Cbz-Tyr(Bn)-OH |
| D-Tyrosine, N-[(phenylmethoxy)carbonyl]-O-(phenylmethyl)- |
| Z-Tyr(OBzl)-OH |
| N-Cbz-L-tyrosine(OBn) |
| N-Cbz-L-Tyr(O-Bn)-OH |
| AmbotzZAA1214 |
| Z-D-Tyr(Bzl)-OH |
| O-Benzyl-N-[(benzyloxy)carbonyl]-D-tyrosine |