Introduction:Basic information about CAS 6522-75-4|2-(1-Anthraquinonylamino)-4,6-dichloro-1,3,5-triazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(1-Anthraquinonylamino)-4,6-dichloro-1,3,5-triazine |
|---|
| CAS Number | 6522-75-4 | Molecular Weight | 371.17700 |
|---|
| Density | 1.623 | Boiling Point | 649.3ºC at 760 mmHg |
|---|
| Molecular Formula | C17H8Cl2N4O2 | Melting Point | 330ºC |
|---|
| MSDS | / | Flash Point | 346.5ºC |
|---|
Names
| Name | 1-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]anthracene-9,10-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.623 |
|---|
| Boiling Point | 649.3ºC at 760 mmHg |
|---|
| Melting Point | 330ºC |
|---|
| Molecular Formula | C17H8Cl2N4O2 |
|---|
| Molecular Weight | 371.17700 |
|---|
| Flash Point | 346.5ºC |
|---|
| Exact Mass | 370.00200 |
|---|
| PSA | 84.84000 |
|---|
| LogP | 3.77040 |
|---|
| Index of Refraction | 1.738 |
|---|
| InChIKey | GUJADTQBTAIXOR-UHFFFAOYSA-N |
|---|
| SMILES | O=C1c2ccccc2C(=O)c2c(Nc3nc(Cl)nc(Cl)n3)cccc21 |
|---|
Safety Information
Customs
| HS Code | 2933699090 |
|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|---|
Synonyms
| 2-(1-ANTHRAQUINONYLAMINO)-4,6-DICHLORO-1,3,5-TRIAZINE |
| 1-[(4,6-Dichloro-s-triazin-2-yl)amino]anthraquinone |
| 1-(4,6-dichloro-[1,3,5]triazin-2-ylamino)-anthraquinone |
| 2-(Anthraquinon-1-ylamino)-4,6-dichloro-s-triazine |
| Anthraquinone,1-[(4,6-dichloro-s-triazin-2-yl)amino]-(7CI,8CI) |
| 9,10-Anthracenedione,1-[(4,6-dichloro-1,3,5-triazin-2-yl)amino] |
| 1-(4,6-Dichlor-[1,3,5]triazin-2-ylamino)-anthrachinon |