Introduction：Basic information about CAS 7748-20-1|(Disulfanediyldi-4,1-phenylene)dimethanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (Disulfanediyldi-4,1-phenylene)dimethanol |
|---|
| CAS Number | 7748-20-1 | Molecular Weight | 278.390 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 465.9±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H14O2S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 226.0±26.0 °C |
|---|
Names
| Name | [4-[[4-(hydroxymethyl)phenyl]disulfanyl]phenyl]methanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 465.9±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H14O2S2 |
|---|
| Molecular Weight | 278.390 |
|---|
| Flash Point | 226.0±26.0 °C |
|---|
| Exact Mass | 278.043518 |
|---|
| PSA | 91.06000 |
|---|
| LogP | 2.04 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.705 |
|---|
| InChIKey | CITNLQICZFPYKK-UHFFFAOYSA-N |
|---|
| SMILES | OCc1ccc(SSc2ccc(CO)cc2)cc1 |
|---|
Synonyms
| 4,4'-disulfanediyl-di-benzyl alcohol |
| 4-(hydroxymethyl)phenyl disulfide |
| (Disulfanediyldi-4,1-phenylene)dimethanol |
| Benzenemethanol,4,4'-dithiobis |
| 4,4'-disulfanediylbis(4,1-phenylene)dimethanol |
| 4,4'-Dithiobisbenzenemethanol |
| 4,4'-Disulfandiyl-di-benzylalkohol |
| (Disulfanediylbis(4,1-phenylene))dimethanol |
| Bis-(4-hydroxymethyl-phenyl)-disulfid |
| 4,4'-dithiobis(benzyl alcohol) |
| Bis[4-(hydroxymethyl)phenyl] disulfide |
| Benzenemethanol, 4,4'-dithiobis- |
