Introduction:Basic information about CAS 1822-66-8|Diethyl 3,4-dihydroxy-2,5-thiophenedicarboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Diethyl 3,4-dihydroxy-2,5-thiophenedicarboxylate |
|---|
| CAS Number | 1822-66-8 | Molecular Weight | 260.264 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 397.7±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H12O6S | Melting Point | 132-135ºC(lit.) |
|---|
| MSDS | / | Flash Point | 194.3±26.5 °C |
|---|
Names
| Name | diethyl 3,4-dihydroxythiophene-2,5-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 397.7±37.0 °C at 760 mmHg |
|---|
| Melting Point | 132-135ºC(lit.) |
|---|
| Molecular Formula | C10H12O6S |
|---|
| Molecular Weight | 260.264 |
|---|
| Flash Point | 194.3±26.5 °C |
|---|
| Exact Mass | 260.035461 |
|---|
| PSA | 121.30000 |
|---|
| LogP | 4.11 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.578 |
|---|
| InChIKey | YOKOBAHUBJPMGP-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1sc(C(=O)OCC)c(O)c1O |
|---|
Safety Information
| Hazard Codes | T: Toxic;Xi: Irritant; |
|---|
| Risk Phrases | 61-20/21-36-36/37/38 |
|---|
| Safety Phrases | 53-45-36-26 |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2,5-bis(ethoxycarbonyl)-3,4-dihydroxythiophene |
| 2,5-Bis(ethoxycarbonyl)thiophene-3,4-diol |
| Diethyl 3,4-dihydroxythiophene-2,5-dicarboxylate |
| ethyl 3,4-dihydroxy-2,5-thiophene-dicarboxylate |
| ethyl 3,4-dihydroxythiophene-2,5-dicarboxylate |
| diethyl 3,4-dihydroxythiphene-2,5-dicarboxylate |
| Diethyl 3,4-dihydroxy-2,5-thiophenedicarboxylate |
| 2,5-Thiophenedicarboxylic acid, 3,4-dihydroxy-, diethyl ester |
| ethyl 5-(ethoxycarbonyl)-3,4-dihydroxythiophene-2-carboxylate |
| 3,4-dihydroxy-2,5-thiophenedicarboxylic acid diethyl ester |
| MFCD03094035 |
| 2,5-bis[ethoxy(hydroxy)methylidene]thiolane-3,4-dione |
| 3,4-Dihydroxythiophene-2,5-dicarboxylic acid diethyl ester |