Introduction:Basic information about CAS 921939-09-5|1-methyl-5-phenoxy-3-(trifluoromethyl)pyrazole-4-carbonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-methyl-5-phenoxy-3-(trifluoromethyl)pyrazole-4-carbonyl chloride |
|---|
| CAS Number | 921939-09-5 | Molecular Weight | 304.65200 |
|---|
| Density | 1.44g/cm3 | Boiling Point | 363.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H8ClF3N2O2 | Melting Point | 44.5-46.5ºC |
|---|
| MSDS | / | Flash Point | 173.5ºC |
|---|
Names
| Name | 1-methyl-5-phenoxy-3-(trifluoromethyl)pyrazole-4-carbonyl chloride |
|---|
Chemical & Physical Properties
| Density | 1.44g/cm3 |
|---|
| Boiling Point | 363.3ºC at 760 mmHg |
|---|
| Melting Point | 44.5-46.5ºC |
|---|
| Molecular Formula | C12H8ClF3N2O2 |
|---|
| Molecular Weight | 304.65200 |
|---|
| Flash Point | 173.5ºC |
|---|
| Exact Mass | 304.02300 |
|---|
| PSA | 44.12000 |
|---|
| LogP | 3.61020 |
|---|
| Index of Refraction | 1.544 |
|---|
| InChIKey | SNBCZQCICOQZPC-UHFFFAOYSA-N |
|---|
| SMILES | Cn1nc(C(F)(F)F)c(C(=O)Cl)c1Oc1ccccc1 |
|---|