Introduction：Basic information about CAS 348-90-3|Acetamide, N-(4-chloro-3-(trifluoromethyl)phenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Acetamide, N-(4-chloro-3-(trifluoromethyl)phenyl)- |
|---|
| CAS Number | 348-90-3 | Molecular Weight | 237.60600 |
|---|
| Density | 1.414g/cm3 | Boiling Point | 328.9ºC at 760 mmHg |
|---|
| Molecular Formula | C9H7ClF3NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 152.7ºC |
|---|
Names
| Name | N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.414g/cm3 |
|---|
| Boiling Point | 328.9ºC at 760 mmHg |
|---|
| Molecular Formula | C9H7ClF3NO |
|---|
| Molecular Weight | 237.60600 |
|---|
| Flash Point | 152.7ºC |
|---|
| Exact Mass | 237.01700 |
|---|
| PSA | 29.10000 |
|---|
| LogP | 3.39020 |
|---|
| Index of Refraction | 1.511 |
|---|
| InChIKey | LWEJZUHNFUXTEC-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
|---|
Synonyms
| 3-acetamido-6-chlorobenzotrifluoride |
| 4-Acetamino-1-chlor-2-trifluormethyl-benzol |
| Acetamide,N-(4-chloro-3-(trifluoromethyl)phenyl) |
| N-<4-chloro-3-(trifluoromethyl)phenyl>acetamide |
