Introduction:Basic information about CAS 5873-11-0|N-((4-methylphenyl)sulfonyl)serine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-((4-methylphenyl)sulfonyl)serine |
|---|
| CAS Number | 5873-11-0 | Molecular Weight | 259.27900 |
|---|
| Density | 1.425g/cm3 | Boiling Point | 492.5ºC at 760 mmHg |
|---|
| Molecular Formula | C10H13NO5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 251.6ºC |
|---|
Names
| Name | 3-hydroxy-2-[(4-methylphenyl)sulfonylamino]propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.425g/cm3 |
|---|
| Boiling Point | 492.5ºC at 760 mmHg |
|---|
| Molecular Formula | C10H13NO5S |
|---|
| Molecular Weight | 259.27900 |
|---|
| Flash Point | 251.6ºC |
|---|
| Exact Mass | 259.05100 |
|---|
| PSA | 112.08000 |
|---|
| LogP | 1.19050 |
|---|
| Index of Refraction | 1.584 |
|---|
| InChIKey | SBKRCXFSPMKXAU-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)NC(CO)C(=O)O)cc1 |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| N-tosyl-L-serine |
| 3-Hydroxy-2-(toluene-4-sulfonylamino)-propionic acid |
| N-(4-toluenesulfonyl)-L-serine |
| 3-hydroxy-2(S)-{[(4-methylphenyl)sulfonyl]amino}propanoic acid |
| 4-toluenesulfonyl-L-serine |
| N-(p-toluene-sulphonyl)-L-serine |
| N-((4-methylphenyl)sulfonyl)serine |
| 3-hydroxy-2-([(4-methylphenyl)sulfonyl]amino)propanoic acid |
| N-(toluene-4-sulfonyl)-L-serine |