Introduction：Basic information about CAS 78-73-9|Choline bicarbonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Choline bicarbonate |
|---|
| CAS Number | 78-73-9 | Molecular Weight | 165.18800 |
|---|
| Density | 1.152 g/mL at 25 °C | Boiling Point | / |
|---|
| Molecular Formula | C6H15NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | hydrogen carbonate,2-hydroxyethyl(trimethyl)azanium |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.152 g/mL at 25 °C |
|---|
| Molecular Formula | C6H15NO4 |
|---|
| Molecular Weight | 165.18800 |
|---|
| Exact Mass | 165.10000 |
|---|
| PSA | 80.59000 |
|---|
| Index of Refraction | n20/D 1.45 |
|---|
| InChIKey | DQKGOGJIOHUEGK-UHFFFAOYSA-M |
|---|
| SMILES | C[N+](C)(C)CCO.O=C([O-])O |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
Synonyms
| 2-hydroxy-n,n,n-trimethylethanaminium hydrogen carbonate |
| Choline hydrogen carbonate |
| cholinium bicarbonate |
| choline bicarbonate |
| UNII-V23DAH2UHH |
| Choline carbonate (1:1) |
| cholin hydrogencarbonate |
| MFCD00031689 |
| (2-Hydroxyethyl)trimethylammonium bicarbonate |
| EINECS 201-137-0 |
| Hydroxyethyltrimethylammonium bicarbonate |
| cholinium hydrogencarbonate |
