Introduction：Basic information about CAS 187960-08-3|Genistein-2',3',5',6'-d4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Genistein-2',3',5',6'-d4 |
|---|
| CAS Number | 187960-08-3 | Molecular Weight | 274.262 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 555.5±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H6D4O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 217.1±23.6 °C |
|---|
Names
| Name | 5,7-dihydroxy-3-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)chromen-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 555.5±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H6D4O5 |
|---|
| Molecular Weight | 274.262 |
|---|
| Flash Point | 217.1±23.6 °C |
|---|
| Exact Mass | 274.077942 |
|---|
| PSA | 90.90000 |
|---|
| LogP | 2.96 |
|---|
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.732 |
|---|
| InChIKey | TZBJGXHYKVUXJN-RHQRLBAQSA-N |
|---|
| SMILES | O=c1c(-c2ccc(O)cc2)coc2cc(O)cc(O)c12 |
|---|
Synonyms
| Baichanin A-d4 |
| 4H-1-Benzopyran-4-one, 5,7-dihydroxy-3-(4-hydroxyphenyl-2,3,5,6-d)- |
| 4',5,7-Trihydroxyisoflavone-d4 |
| Genisteol-d4 |
| Bonistein-d4 |
| GeniVida-d4 |
| 2',3',5',6'-tetradeuterogenistein |
| Sophoricol-d4 |
| 5,7-Dihydroxy-3-[4-hydroxy(H)phenyl]-4H-chromen-4-one |
| Prunetol-d4 |
