Introduction：Basic information about CAS 188814-36-0|3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-fluorophenyl)propanoic aci, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-fluorophenyl)propanoic acid |
|---|
| CAS Number | 188814-36-0 | Molecular Weight | 405.41800 |
|---|
| Density | 1.316g/cm3 | Boiling Point | 617.6ºC at 760mmHg |
|---|
| Molecular Formula | C24H20FNO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 327.3ºC |
|---|
Names
| Name | 3-n-fmoc-3-(4-fluorophenyl)propionic acid |
|---|
Chemical & Physical Properties
| Density | 1.316g/cm3 |
|---|
| Boiling Point | 617.6ºC at 760mmHg |
|---|
| Molecular Formula | C24H20FNO4 |
|---|
| Molecular Weight | 405.41800 |
|---|
| Flash Point | 327.3ºC |
|---|
| Exact Mass | 405.13800 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 5.27110 |
|---|
| Vapour Pressure | 4.11E-16mmHg at 25°C |
|---|
| Index of Refraction | 1.621 |
|---|
| InChIKey | PQXRHKBSMBRBBW-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)c1ccc(F)cc1 |
|---|
