Introduction：Basic information about CAS 65-04-3|17a-Methyl-1-testosterone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 17a-Methyl-1-testosterone |
|---|
| CAS Number | 65-04-3 | Molecular Weight | 302.451 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 422.7±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H30O2 | Melting Point | 154-155ºC |
|---|
| MSDS | / | Flash Point | 180.4±21.3 °C |
|---|
Names
| Name | 17α-Methyl-1-testosterone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 422.7±45.0 °C at 760 mmHg |
|---|
| Melting Point | 154-155ºC |
|---|
| Molecular Formula | C20H30O2 |
|---|
| Molecular Weight | 302.451 |
|---|
| Flash Point | 180.4±21.3 °C |
|---|
| Exact Mass | 302.224579 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 3.98 |
|---|
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.541 |
|---|
| InChIKey | JRNSSSJKIGAFCT-YDSAWKJFSA-N |
|---|
| SMILES | CC12C=CC(=O)CC1CCC1C2CCC2(C)C1CCC2(C)O |
|---|
| Water Solubility | H2O: ≤0.5 mg/mL |
|---|
Safety Information
| Hazard Codes | T |
|---|
| Risk Phrases | R45 |
|---|
| Safety Phrases | 53-36/37-45 |
|---|
| WGK Germany | 3 |
|---|
| RTECS | BV8400000 |
|---|
Synonyms
| EINECS 200-366-3 |
| 17a-Methyl-1-testosterone |
| Adroyd |
| Anadroyd |
| Anadrol |
| 17-Methyl-1-Testosterone : (5 a ,17 b )-17-Hydroxy-17-methylandrosta-1-en-3-one |
| Adroidin |
| Roboral |
| Androst-1-en-3-one, 17-hydroxy-17-methyl-, (5α,17β)- |
| Becorel |
| 17-methyl-1-testosterone |
| ci406 |
| MFCD00003655 |
| (5α,17β)-17-Hydroxy-17-methylandrost-1-en-3-one |
| Raboral |
