Introduction:Basic information about CAS 65355-31-9|trans-4-Heptylcyclohexanecarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | trans-4-Heptylcyclohexanecarboxylic acid |
|---|
| CAS Number | 65355-31-9 | Molecular Weight | 226.35500 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C14H26O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | trans-4-Heptylcyclohexanecarboxylic acid |
|---|
Chemical & Physical Properties
| Molecular Formula | C14H26O2 |
|---|
| Molecular Weight | 226.35500 |
|---|
| Exact Mass | 226.19300 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 4.23790 |
|---|
| Index of Refraction | 1.467 |
|---|
| InChIKey | RHHMSVOVPSNAEC-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCC1CCC(c2ccc(C(=O)O)cc2)CC1 |
|---|