Introduction：Basic information about CAS 65731-84-2|(1R)-trans-(αS)-cypermethrin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (1R)-trans-(αS)-cypermethrin |
|---|
| CAS Number | 65731-84-2 | Molecular Weight | 416.297 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 511.3±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C22H19Cl2NO3 | Melting Point | 60-80ºC |
|---|
| MSDS | / | Flash Point | 263.0±30.1 °C |
|---|
Names
| Name | β-CYPERMETHRIN |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 511.3±50.0 °C at 760 mmHg |
|---|
| Melting Point | 60-80ºC |
|---|
| Molecular Formula | C22H19Cl2NO3 |
|---|
| Molecular Weight | 416.297 |
|---|
| Flash Point | 263.0±30.1 °C |
|---|
| Exact Mass | 415.074188 |
|---|
| PSA | 59.32000 |
|---|
| LogP | 6.27 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.622 |
|---|
| InChIKey | KAATUXNTWXVJKI-NSHGMRRFSA-N |
|---|
| SMILES | CC1(C)C(C=C(Cl)Cl)C1C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1 |
|---|
Safety Information
| Hazard Codes | Xn;N |
|---|
| Risk Phrases | R22;R37/38;R43;R50/53 |
|---|
| Safety Phrases | S2-S36/37/39-S60-S61 |
|---|
Synonyms
| prussic acid |
| methylnitrile |
| Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (S)-cyano(3-phenoxyphenyl)methyl ester, (1R,3S)- |
| θ-cypermethrin |
| alphamethrin |
| UNII:ZE304V7A62 |
| (S)-Cyano(3-phenoxyphenyl)methyl (1R,3S)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate |
| hydrocyanic acid |
| Blausaeure |
| Evercyn |
| Cyanwasserstoff |
| Formic anammonide |
| Zyklon B |
| Zaclondiscoids |
| carbonitrile |
