Introduction：Basic information about CAS 34529-06-1|3-amino-1,2-benzene dicarboxylic acid,1-ethylester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-amino-1,2-benzene dicarboxylic acid,1-ethylester |
|---|
| CAS Number | 34529-06-1 | Molecular Weight | 245.660 |
|---|
| Density | 1.249g/cm3 | Boiling Point | 305.581ºC at 760 mmHg |
|---|
| Molecular Formula | C10H12ClNO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 136.388ºC |
|---|
Names
| Name | dimethyl 3-aminobenzene-1,2-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.249g/cm3 |
|---|
| Boiling Point | 305.581ºC at 760 mmHg |
|---|
| Molecular Formula | C10H12ClNO4 |
|---|
| Molecular Weight | 245.660 |
|---|
| Flash Point | 136.388ºC |
|---|
| Exact Mass | 245.045486 |
|---|
| PSA | 78.62000 |
|---|
| LogP | 1.42320 |
|---|
| Index of Refraction | 1.558 |
|---|
| InChIKey | VEJKSNHPNFHCLF-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cccc(N)c1C(=O)OC |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
Synonyms
| 3-Amino-phthalsaeure-dimethylester |
| methyl 2-amino-6-(methoxycarbonyl)benzoate |
| 3-Amino-phthalic acid dimethyl ester |
| 1,2-Benzenedicarboxylic acid, 3-amino-, dimethyl ester, hydrochloride (1:1) |
| Dimethyl 3-aminophthalate hydrochloride (1:1) |
| dimethyl-3-aminophthalate |
| methyl-3-amino-2-(methoxycarbonyl)benzoate |
| 3-amino-1,2-benzene dicarboxylic acid,1-ethylester |
