Introduction：Basic information about CAS 1712-87-4|m-Toluoyl and benzoyl peroxide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | m-Toluoyl and benzoyl peroxide |
|---|
| CAS Number | 1712-87-4 | Molecular Weight | 270.28000 |
|---|
| Density | 1.198g/cm3 | Boiling Point | 404.508ºC at 760 mmHg |
|---|
| Molecular Formula | C16H14O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 179.191ºC |
|---|
Names
| Name | (3-methylbenzoyl) 3-methylbenzenecarboperoxoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.198g/cm3 |
|---|
| Boiling Point | 404.508ºC at 760 mmHg |
|---|
| Molecular Formula | C16H14O4 |
|---|
| Molecular Weight | 270.28000 |
|---|
| Flash Point | 179.191ºC |
|---|
| Exact Mass | 270.08900 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 3.23220 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.573 |
|---|
| InChIKey | NLBJAOHLJABDAU-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cccc(C(=O)OOC(=O)c2cccc(C)c2)c1 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Peroxide,bis(3-methylbenzoyl) |
| Nyper MT 80 |
| di-m-toluoyl peroxide |
| m-Methylbenzoyl peroxide |
| Bis-<3-methylbenzoyl>-peroxid |
| Nyper MT |
| (3-methylphenyl)carbonyl 3-methylbenzenecarboperoxoate |
| Di-(2-methylbenzoyl)peroxide |
| Di-m-toluoyl-peroxid |
| m-Toluoyl peroxide |
| bis(m-methylbenzoyl)-peroxide |
| bis-(m-toluoyl)peroxide |
