Introduction：Basic information about CAS 454431-03-9|2-(6-methoxynaphthalen-2-yl)ethynyl-trimethylsilane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(6-methoxynaphthalen-2-yl)ethynyl-trimethylsilane |
|---|
| CAS Number | 454431-03-9 | Molecular Weight | 254.39900 |
|---|
| Density | 1.02g/cm3 | Boiling Point | 341.4ºC at 760 mmHg |
|---|
| Molecular Formula | C16H18OSi | Melting Point | 99-103ºC(lit.) |
|---|
| MSDS | / | Flash Point | 125.1ºC |
|---|
Names
| Name | 2-(6-methoxynaphthalen-2-yl)ethynyl-trimethylsilane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.02g/cm3 |
|---|
| Boiling Point | 341.4ºC at 760 mmHg |
|---|
| Melting Point | 99-103ºC(lit.) |
|---|
| Molecular Formula | C16H18OSi |
|---|
| Molecular Weight | 254.39900 |
|---|
| Flash Point | 125.1ºC |
|---|
| Exact Mass | 254.11300 |
|---|
| PSA | 9.23000 |
|---|
| LogP | 4.07730 |
|---|
| Index of Refraction | 1.565 |
|---|
| InChIKey | CIRBLQJTKYVIDP-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2cc(C#C[Si](C)(C)C)ccc2c1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26 |
|---|
Synonyms
| (6-Methoxynaphthalen-2-ylethynyl)trimethylsilane |
| 2-methoxy-6-[2-(trimethylsilyl)ethynyl]naphthalene |
| MFCD05865186 |
| 1-(6-methoxy-2-naphthyl)-2-trimethylsilylacetylene |
| 2-methoxy-6-(trimethylsilylethynyl)naphthalene |
