Introduction：Basic information about CAS 79817-49-5|N-[4-[[(4-chloro-3-nitrophenyl)sulphonyl]amino]phenyl]acetamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[4-[[(4-chloro-3-nitrophenyl)sulphonyl]amino]phenyl]acetamide |
|---|
| CAS Number | 79817-49-5 | Molecular Weight | 369.78000 |
|---|
| Density | 1.57g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C14H12ClN3O5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | N-[4-[(4-chloro-3-nitrophenyl)sulfonylamino]phenyl]acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.57g/cm3 |
|---|
| Molecular Formula | C14H12ClN3O5S |
|---|
| Molecular Weight | 369.78000 |
|---|
| Exact Mass | 369.01900 |
|---|
| PSA | 132.96000 |
|---|
| LogP | 5.33390 |
|---|
| Index of Refraction | 1.668 |
|---|
| InChIKey | FAGBGCWSFWSOHI-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Nc1ccc(NS(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)cc1 |
|---|
Synonyms
| Essigsaeure-[4-(4-chlor-3-nitro-benzol-sulfonyl-(1)-amino)-anilid] |
| N-(4-{[(4-chloro-3-nitrophenyl)sulfonyl]amino}phenyl)acetamide |
| N-[4-[[(4-chloro-3-nitrophenyl)sulphonyl]amino]phenyl]acetamide |
| N'-(4-Chlor-3-nitro-benzol-sulfonyl-(1))-N-acetyl-p-phenylendiamin |
| 1-Acetylamino-4-(4-chlor-3-nitro-benzolsulfonylamino)-benzol |
| 1-acetylamino-4-(4-chloro-3-nitro-benzenesulfonylamino)-benzene |
| 3-Nitro-4-Chloro-4'-Acetamido Benzene Sulfonamide |
