Introduction：Basic information about CAS 632-02-0|3-Chloropropyl p-toluenesulfonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Chloropropyl p-toluenesulfonate |
|---|
| CAS Number | 632-02-0 | Molecular Weight | 248.726 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 375.6±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H13ClO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 181.0±23.2 °C |
|---|
Names
| Name | 3-chloropropyl 4-methylbenzenesulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 375.6±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H13ClO3S |
|---|
| Molecular Weight | 248.726 |
|---|
| Flash Point | 181.0±23.2 °C |
|---|
| Exact Mass | 248.027390 |
|---|
| PSA | 51.75000 |
|---|
| LogP | 2.29 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.524 |
|---|
| InChIKey | NQCQVNHLNXCSPY-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)OCCCCl)cc1 |
|---|
Synonyms
| 1-Propanol, 3-chloro-, 4-methylbenzenesulfonate |
| 3-chloro-1-propyl tosylate |
| 3-chloropropyl tosylate |
| 3-Chloropropyl p-toluenesulfonate |
| 1-Chloro-3-(tolene-p-sulphonyloxy) propane |
| 3-Chloropropyl 4-methylbenzenesulfonate |
