Introduction：Basic information about CAS 71130-06-8|Ranitidine hydrochloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ranitidine hydrochloride |
|---|
| CAS Number | 71130-06-8 | Molecular Weight | 350.865 |
|---|
| Density | / | Boiling Point | 437.1ºC at 760 mmHg |
|---|
| Molecular Formula | C13H23ClN4O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 218.2ºC |
|---|
Names
| Name | Ranitidine Hydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 437.1ºC at 760 mmHg |
|---|
| Molecular Formula | C13H23ClN4O3S |
|---|
| Molecular Weight | 350.865 |
|---|
| Flash Point | 218.2ºC |
|---|
| Exact Mass | 350.117950 |
|---|
| PSA | 111.56000 |
|---|
| LogP | 3.56600 |
|---|
| InChIKey | GGWBHVILAJZWKJ-UHFFFAOYSA-N |
|---|
| SMILES | CNC(=C[N+](=O)[O-])NCCSCc1ccc(CN(C)C)o1.Cl |
|---|
| Water Solubility | H2O: 1.8 mg/mL |
|---|
Safety Information
| Safety Phrases | S22-S24/25 |
|---|
| WGK Germany | 2 |
|---|
| RTECS | KM6557000 |
|---|
| HS Code | 2933990090 |
|---|
Customs
| HS Code | 2932190090 |
|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| Sostril |
| Terposen |
| Raniben |
| Ultidine |
| 1,1-Ethenediamine, N-[2-[[[5-[(dimethylamino)methyl]-2-furanyl]methyl]thio]ethyl]-N'-methyl-2-nitro-, hydrochloride (1:1) |
| Ranitidine HCl salt |
| EINECS 275-207-4 |
| Noctone |
| Taural |
| Zantac |
| Trigger |
| UNII-BK76465IHM |
| Raniplex |
| Ranidil |
| Zantic |
| Ranitidine hydrochloride |
| MFCD00069339 |
| Azantac |
| N-{2-[({5-[(Dimethylamino)methyl]-2-furyl}methyl)sulfanyl]ethyl}-N'-methyl-2-nitro-1,1-ethenediamine hydrochloride (1:1) |
| Ulcex |
