Introduction:Basic information about CAS 18407-94-8|Tetrakis(2-ethoxyethyl) orthosilicate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tetrakis(2-ethoxyethyl) orthosilicate |
|---|
| CAS Number | 18407-94-8 | Molecular Weight | 384.538 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 364.4±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H36O8Si | Melting Point | <0ºC |
|---|
| MSDS | / | Flash Point | 147.4±28.3 °C |
|---|
Names
| Name | tetrakis(2-ethoxyethyl) silicate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 364.4±42.0 °C at 760 mmHg |
|---|
| Melting Point | <0ºC |
|---|
| Molecular Formula | C16H36O8Si |
|---|
| Molecular Weight | 384.538 |
|---|
| Flash Point | 147.4±28.3 °C |
|---|
| Exact Mass | 384.217957 |
|---|
| PSA | 73.84000 |
|---|
| LogP | 5.14 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.434 |
|---|
| InChIKey | OTTUQUOINFJTBJ-UHFFFAOYSA-N |
|---|
| SMILES | CCOCCO[Si](OCCOCC)(OCCOCC)OCCOCC |
|---|
Safety Information
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| HS Code | 2920909090 |
|---|
Customs
| HS Code | 2920909090 |
|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Silicic acid (H4SiO4),tetrakis(2-ethoxyethyl) ester |
| tetrakis-(2-ethoxy-ethoxy)-silane |
| EINECS 242-287-7 |
| Tetrakis(2-ethoxyethyl) orthosilicate |
| silicic acid tetrakis-(2-ethoxy-ethyl ester) |
| Tetrakis-(2-aethoxy-aethoxy)-silan |
| Silicic acid (HSiO), tetrakis(2-ethoxyethyl) ester |
| Kieselsaeure-tetrakis-(2-aethoxy-aethylester) |
| Tetrakis-(2-aethoxy-aethyl)-orthosilicat |
| Si(Oet-2-Oet)4 |
| TETRAKIS(ETHOXYETHOXY)SILANE |