Introduction:Basic information about CAS 976-56-7|Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate |
|---|
| CAS Number | 976-56-7 | Molecular Weight | 356.43700 |
|---|
| Density | 1.046g/cm3 | Boiling Point | 417ºC at 760mmHg |
|---|
| Molecular Formula | C19H33O4P | Melting Point | 122 °C |
|---|
| MSDS | / | Flash Point | 206ºC |
|---|
Names
| Name | 3,5-di-tert-butyl-4-hydroxybenzyl-phosphonic acid diethyl ester |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.046g/cm3 |
|---|
| Boiling Point | 417ºC at 760mmHg |
|---|
| Melting Point | 122 °C |
|---|
| Molecular Formula | C19H33O4P |
|---|
| Molecular Weight | 356.43700 |
|---|
| Flash Point | 206ºC |
|---|
| Exact Mass | 356.21200 |
|---|
| PSA | 65.57000 |
|---|
| LogP | 5.75330 |
|---|
| Index of Refraction | 1.491 |
|---|
| InChIKey | GJDRKHHGPHLVNI-UHFFFAOYSA-N |
|---|
| SMILES | CCOP(=O)(Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)OCC |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
Synonyms
| Phosphonic acid,[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]-,diethyl ester |
| Diethyl ((3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl)methyl)phosphonate |
| diethyl(3,5-di-tert-butyl-4-hydroxybenzyl)phosphonate |
| EINECS 213-551-9 |
| diethyl (3,5-di-tert-butyl-4-hydroxyphenyl)methanephosphonate |
| MFCD00227871 |
| diethyl 4-hydroxy-3,5-di-tert-butylbenzylphosphonate |
| O,O-diethyl (3,5-ditert-butyl-4-hydroxybenzyl)phosphonate |
| 4-Hydroxy-3.5-di-tert.-butyl-phenyl-methan-phosphonsaeurediethylester |