Introduction:Basic information about CAS 4711-68-6|N-(4-Ethoxyphenyl)-3-hydroxy-2-naphthamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(4-Ethoxyphenyl)-3-hydroxy-2-naphthamide |
|---|
| CAS Number | 4711-68-6 | Molecular Weight | 307.34300 |
|---|
| Density | 1.273 g/cm3 | Boiling Point | 438.7ºC at 760 mmHg |
|---|
| Molecular Formula | C19H17NO3 | Melting Point | 217-219ºC |
|---|
| MSDS | / | Flash Point | 219.1ºC |
|---|
Names
| Name | N-(4-ethoxyphenyl)-3-hydroxynaphthalene-2-carboxamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.273 g/cm3 |
|---|
| Boiling Point | 438.7ºC at 760 mmHg |
|---|
| Melting Point | 217-219ºC |
|---|
| Molecular Formula | C19H17NO3 |
|---|
| Molecular Weight | 307.34300 |
|---|
| Flash Point | 219.1ºC |
|---|
| Exact Mass | 307.12100 |
|---|
| PSA | 58.56000 |
|---|
| LogP | 4.26940 |
|---|
| Index of Refraction | 1.686 |
|---|
| InChIKey | FYJKEJZGNQVNLC-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1ccc(NC(=O)c2cc3ccccc3cc2O)cc1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| C.I. Azoic Coupling Component 30 |
| EINECS 225-200-7 |
| Cibanaphthol RPH |
| 4'-ethoxy-3-hydroxy-2-naphthanilide |
| 3-Hydroxy-2-naphtho-p-phenetidide |
| 2-Hydroxy-3-naphthoesaeure-p-phenetidid |
| C.I. Azoic Coupling Component 46 |
| N-(4-ethoxyphenyl)-3-hydroxy-2-naphthamide |
| 3-hydroxy-[2]naphthoic acid p-phenetidide |
| Naphthol AS-VL |
| 3-Hydroxy-[2]naphthoesaeure-p-phenetidid |
| Azoic coupling component 46 |