Introduction：Basic information about CAS 4726-22-1|Phenol, 2-amino-4-[[2-(sulfooxy)ethyl]sulfonyl]-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Phenol, 2-amino-4-[[2-(sulfooxy)ethyl]sulfonyl]- |
|---|
| CAS Number | 4726-22-1 | Molecular Weight | 297.30500 |
|---|
| Density | 1.715g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C8H11NO7S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-(3-amino-4-hydroxyphenyl)sulfonylethyl hydrogen sulfate |
|---|
Chemical & Physical Properties
| Density | 1.715g/cm3 |
|---|
| Molecular Formula | C8H11NO7S2 |
|---|
| Molecular Weight | 297.30500 |
|---|
| Exact Mass | 296.99800 |
|---|
| PSA | 160.75000 |
|---|
| LogP | 2.31030 |
|---|
| Index of Refraction | 1.635 |
|---|
| InChIKey | SLLSIPBBZZFAKY-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cc(S(=O)(=O)CCOS(=O)(=O)O)ccc1O |
|---|
