Introduction：Basic information about CAS 5875-45-6|2,5-Di-tert-butylphenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,5-Di-tert-butylphenol |
|---|
| CAS Number | 5875-45-6 | Molecular Weight | 206.324 |
|---|
| Density | 0.9±0.1 g/cm3 | Boiling Point | 283.4±9.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H22O | Melting Point | 141.1-142.2°C (lit.) |
|---|
| MSDS | / | Flash Point | 130.6±7.2 °C |
|---|
Names
| Name | 2,5-ditert-butylphenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|
| Boiling Point | 283.4±9.0 °C at 760 mmHg |
|---|
| Melting Point | 141.1-142.2°C (lit.) |
|---|
| Molecular Formula | C14H22O |
|---|
| Molecular Weight | 206.324 |
|---|
| Flash Point | 130.6±7.2 °C |
|---|
| Exact Mass | 206.167068 |
|---|
| PSA | 20.23000 |
|---|
| LogP | 4.86 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.499 |
|---|
| InChIKey | KDBZVULQVCUNNA-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c(O)c1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| RIDADR | UN 3077 |
|---|
| Packaging Group | III |
|---|
Synonyms
| 2,4-di-tert-butylphenol |
| Phenol, 2,5-bis(1,1-dimethylethyl)- |
| 2,5-Bis(2-methyl-2-propanyl)phenol |
| Phenol,2,5-di-tert-butyl |
| Phenol,2,5-bis(1,1-dimethylethyl) |
| Phenol, 2,5-di-tert-butyl- |
| 2,5-bis(1,1-dimethylethyl)phenol |
| 2,5-Di-tert-butylphenol |
| AC1Q79XC |
| 1-hydroxy-2,5-di-t-butylbenzene |
| 2,4-DICHLORO-6-HYDROXYPHENYLBORONIC ACID |
| 2,5-di-t-butylphenol |
| AC1L2YI4 |
