Introduction：Basic information about CAS 4610-75-7|ethyl 5-hydroxy-2-phenyl-1-benzofuran-3-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 5-hydroxy-2-phenyl-1-benzofuran-3-carboxylate |
|---|
| CAS Number | 4610-75-7 | Molecular Weight | 282.29100 |
|---|
| Density | 1.257g/cm3 | Boiling Point | 471.3ºC at 760 mmHg |
|---|
| Molecular Formula | C17H14O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 238.8ºC |
|---|
Names
| Name | ethyl 5-hydroxy-2-phenyl-1-benzofuran-3-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.257g/cm3 |
|---|
| Boiling Point | 471.3ºC at 760 mmHg |
|---|
| Molecular Formula | C17H14O4 |
|---|
| Molecular Weight | 282.29100 |
|---|
| Flash Point | 238.8ºC |
|---|
| Exact Mass | 282.08900 |
|---|
| PSA | 59.67000 |
|---|
| LogP | 3.98210 |
|---|
| Index of Refraction | 1.624 |
|---|
| InChIKey | WZZJQHPNLFLEMB-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1c(-c2ccccc2)oc2ccc(O)cc12 |
|---|
Synonyms
| 2-Phenyl-3-ethoxycarbonyl-5-hydroxybenzofuran |
| ethyl 5-hydroxy-2-phenylbenzofuran-3-carboxylate |
| 2-Phenyl-3-carbaethoxy-5-hydroxybenzofuran |
| 3-ethoxycarbonyl-5-hydroxy-2-phenyl-1-benzofuran |
| 5-Hydroxy-2-phenyl-benzofuran-3-carbonsaeure-aethylester |
| 5-Hydroxy-2-phenyl-benzofuran-3-carboxylic acid ethyl ester |
