Introduction：Basic information about CAS 28547-08-2|3-(2-chloro-acetylamino)-benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(2-chloro-acetylamino)-benzoic acid |
|---|
| CAS Number | 28547-08-2 | Molecular Weight | 213.61800 |
|---|
| Density | 1.458g/cm3 | Boiling Point | 473ºC at 760 mmHg |
|---|
| Molecular Formula | C9H8ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 239.8ºC |
|---|
Names
| Name | 3-(2-chloro-acetylamino)-benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.458g/cm3 |
|---|
| Boiling Point | 473ºC at 760 mmHg |
|---|
| Molecular Formula | C9H8ClNO3 |
|---|
| Molecular Weight | 213.61800 |
|---|
| Flash Point | 239.8ºC |
|---|
| Exact Mass | 213.01900 |
|---|
| PSA | 66.40000 |
|---|
| LogP | 1.63510 |
|---|
| Vapour Pressure | 9.44E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.633 |
|---|
| InChIKey | UDZHNOUYXZRNPF-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CCl)Nc1cccc(C(=O)O)c1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 3-<(chloroacetyl)amino>benzoic acid |
| 3-<2-Chlor-6-fluor-phenyl>-5-methyl-isoxazol-4-carbonsaeure |
| 3-(2-chloroacetamide)benzoic acid |
| 4-isoxazolecarboxylic acid,3-(2-chloro-6-fluorophenyl)-5-methyl |
| 5-Methyl-3-(2-chlor-6-fluor-phenyl)-4-isoxazol-carbonsaeure |
| 3-(2-Chloro-6-fluorophenyl)-5-methyl-4-isoxazolecarboxic Acid |
| 3-(2-Chlor-acetylamino)-benzoesaeure |
| 3-Chloracetamino-benzoesaeure |
| 3-chloroacetamidobenzoic acid |
| 3-(2-Chloro-6-fluorophenyl)-5-methylisoxazole-4-carboxylic acid |
| 3-(2-chloro-6-flourophenyl)-5-methyl-isoxazole-4-carboxylic acid |
| 3-chloroacetoaminobenzoic acid |
