Introduction:Basic information about CAS 82168-26-1|adafenoxate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | adafenoxate |
|---|
| CAS Number | 82168-26-1 | Molecular Weight | 363.87800 |
|---|
| Density | 1.24g/cm3 | Boiling Point | 489.2ºC at 760 mmHg |
|---|
| Molecular Formula | C20H26ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 249.7ºC |
|---|
Names
| Name | 2-(1-adamantylamino)ethyl 2-(4-chlorophenoxy)acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.24g/cm3 |
|---|
| Boiling Point | 489.2ºC at 760 mmHg |
|---|
| Molecular Formula | C20H26ClNO3 |
|---|
| Molecular Weight | 363.87800 |
|---|
| Flash Point | 249.7ºC |
|---|
| Exact Mass | 363.16000 |
|---|
| PSA | 47.56000 |
|---|
| LogP | 4.21130 |
|---|
| Index of Refraction | 1.58 |
|---|
| InChIKey | PLSMXIQMWYSHIV-UHFFFAOYSA-N |
|---|
| SMILES | O=C(COc1ccc(Cl)cc1)OCCNC12CC3CC(CC(C3)C1)C2 |
|---|
Synonyms
| Adafenoxato [Spanish] |
| Adafenoxatum |
| Adafenoxato |
| Adafenoxatum [Latin] |
| Adafenoxate |