Introduction：Basic information about CAS 929301-98-4|2,8-Diazaspiro[4.5]decane-2,8-dicarboxylic acid, 2-(1,1-dimethylethyl) 8-(phe, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,8-Diazaspiro[4.5]decane-2,8-dicarboxylic acid, 2-(1,1-dimethylethyl) 8-(phenylmethyl) ester |
|---|
| CAS Number | 929301-98-4 | Molecular Weight | 388.50000 |
|---|
| Density | 1.17g/cm3 | Boiling Point | 495.3ºC at 760 mmHg |
|---|
| Molecular Formula | C22H32N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 253.4ºC |
|---|
Names
| Name | 2,8-Diazaspiro[4.5]decane-2,8-dicarboxylic acid, 2-(1,1-dimethylethyl) 8-(phenylmethyl) ester |
|---|
Chemical & Physical Properties
| Density | 1.17g/cm3 |
|---|
| Boiling Point | 495.3ºC at 760 mmHg |
|---|
| Molecular Formula | C22H32N2O4 |
|---|
| Molecular Weight | 388.50000 |
|---|
| Flash Point | 253.4ºC |
|---|
| Exact Mass | 388.23600 |
|---|
| PSA | 59.08000 |
|---|
| LogP | 4.31210 |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | GLTBYYZYOMQYEL-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCN(C(=O)OCc3ccccc3)CC2)C1 |
|---|
